Ethyl N-Boc-4-methylpiperidine-4-carboxylate structure
|
Common Name | Ethyl N-Boc-4-methylpiperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 189442-87-3 | Molecular Weight | 271.35300 | |
| Density | 1.0134 | Boiling Point | 329.7ºC at 760mmHg | |
| Molecular Formula | C14H25NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 110ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 1-O-tert-butyl 4-O-ethyl 4-methylpiperidine-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0134 |
|---|---|
| Boiling Point | 329.7ºC at 760mmHg |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.35300 |
| Flash Point | 110ºC |
| Exact Mass | 271.17800 |
| PSA | 55.84000 |
| LogP | 2.52620 |
| Vapour Pressure | 0.000175mmHg at 25°C |
| Index of Refraction | 1.4554 |
| InChIKey | ZQZVWDXMUCTNRI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C)CCN(C(=O)OC(C)(C)C)CC1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R25;R37/38;R41 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2810 |
| Hazard Class | 6.1 |
| HS Code | 2933399090 |
|
~99%
Ethyl N-Boc-4-m... CAS#:189442-87-3 |
| Literature: ARRAY BIOPHARMA INC. Patent: WO2008/121687 A2, 2008 ; Location in patent: Page/Page column 43; 89; 94 ; WO 2008/121687 A2 |
|
~%
Ethyl N-Boc-4-m... CAS#:189442-87-3 |
| Literature: WO2005/30209 A1, ; Page/Page column 46 ; WO 2005/030209 A1 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Facile synthesis of 4-substituted-4-aminopiperidine derivatives, the key building block of piperazine-based CCR5 antagonists.
Bioorg. Med. Chem. Lett. 14 , 3675, (2004) 4-Substituted-4-aminopiperidine is an interesting structural motif found in a number of bioactive compounds. An efficient and convenient method for the synthesis of 4-differently substituted-4-aminopi... |
| 1-BOC-4-METHYL-ISONIPECOTIC ACID ETHYL ESTER |
| N-tert-butoxycarbonyl-4-methylisonipecotic acid ethyl ester |
| 4-methyl-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-ethvl ester |
| 1-tert-Butyl 4-ethyl 4-methylpiperidine-1,4-dicarboxylate |
| Ethyl N-Boc-4-methylpiperidine-4-carboxylate |
| 1-BOC-4-METHYLPIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER |
| Ethyl N-Boc-4-Methylpiperidine-4-Carboxylate |
| 4-methyl piperidine-1,4-dicarboxylic acid-1-tert-butylester 4-ethyl ester |
| 4-Methyl-1,4-piperidinedicarboxylic acid 1-(1,1-dimethylethyl) 4-ethyl ester |
| Ethyl 1-N-Boc-4-methyl-piperidine-carboxylate |
| ethyl N-t-butoxycarbonyl-4-methylpiperidine-4-carboxylate |
| O1-tert-butyl O4-ethyl 4-methylpiperidine-1,4-dicarboxylate |
| 1-tert-butyl 4-ethyl 4-methylpiperidine-1,4-dicarboxylate |
| 1-tert-Butoxycarbonyl-4-methylpiperidine-4-carboxylic acid ethyl ester |