SC-68448 structure
|
Common Name | SC-68448 | ||
|---|---|---|---|---|
| CAS Number | 188804-07-1 | Molecular Weight | 452.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19Cl2N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SC-68448SC-68448 (SC68448) is a potent, selective peptidomimetic antagonist of the integrin αvβ3 with IC50 of 1 nM, 100-fold selectivity over αIIbβ3. |
| Name | sc-68448 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H19Cl2N5O4 |
|---|---|
| Molecular Weight | 452.29100 |
| Exact Mass | 451.08100 |
| PSA | 157.40000 |
| LogP | 4.01560 |
| InChIKey | XWMBYGCYHWLPMQ-UHFFFAOYSA-N |
| SMILES | NC(N)=Nc1cccc(C(=O)NCC(=O)NC(CC(=O)O)c2cc(Cl)cc(Cl)c2)c1 |
| β-[[2-[[[3-[(aminoiminomethyl)amino]phenyl]carbonyl]amino]acetyl]amino]-3,5-dichlorobenzenepropanoic acid |