SC-VC-PAB-N-Me-L-Ala-Maytansinol
Modify Date: 2025-08-22 12:29:43
SC-VC-PAB-N-Me-L-Ala-Maytansinol structure
|
Common Name | SC-VC-PAB-N-Me-L-Ala-Maytansinol | ||
|---|---|---|---|---|
| CAS Number | 2226467-76-9 | Molecular Weight | 1365.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C65H89ClN10O20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SC-VC-PAB-N-Me-L-Ala-MaytansinolSC-VC-PAB-N-Me-L-Ala-Maytansinol (compound B1) can be used to synthesis MCC-Maytansinoid A. SC-VC-PAB-N-Me-L-Ala-Maytansinol can be used as a control compound for the cancer research[1]. |
| Name | SC-VC-PAB-N-Me-L-Ala-Maytansinol |
|---|
| Description | SC-VC-PAB-N-Me-L-Ala-Maytansinol (compound B1) can be used to synthesis MCC-Maytansinoid A. SC-VC-PAB-N-Me-L-Ala-Maytansinol can be used as a control compound for the cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C65H89ClN10O20 |
|---|---|
| Molecular Weight | 1365.91 |
| InChIKey | NHXRUZDRXYIEFH-XLXNGGFGSA-N |
| SMILES | COc1cc2cc(c1Cl)N(C)C(=O)CC(OC(=O)C(C)N(C)C(=O)CCN(C)C(=O)OCc1ccc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)CCCCC(=O)ON3C(=O)CCC3=O)C(C)C)cc1)C1(C)OC1C(C)C1CC(O)(NC(=O)O1)C(OC)C=CC=C(C)C2 |