SC-53116 HCl structure
|
Common Name | SC-53116 HCl | ||
|---|---|---|---|---|
| CAS Number | 141196-99-8 | Molecular Weight | 323.81800 | |
| Density | 1.3g/cm3 | Boiling Point | 468.4ºC at 760 mmHg | |
| Molecular Formula | C16H22ClN3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 237.1ºC | |
Use of SC-53116 HClSC-53116 HCl is a psychoactive agent, increasing in production of serotonin in central nervous system tissue. |
| Name | SC-53116 hydrochloride hydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 468.4ºC at 760 mmHg |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.81800 |
| Flash Point | 237.1ºC |
| Exact Mass | 323.14000 |
| PSA | 71.08000 |
| LogP | 3.23880 |
| Vapour Pressure | 6E-09mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | GAYSOZKZPOVDSB-HZMBPMFUSA-N |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1CCN2CCCC12 |
| 4-Amino-5-chloro-N-[(1S,7aS)-hexahydro-1H-pyrrolizin-1-ylmethyl]- 2-methoxybenzamide |