T-2513 hydrochloride structure
|
Common Name | T-2513 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 187793-52-8 | Molecular Weight | 485.96 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of T-2513 hydrochlorideT-2513 hydrochloride is a selective topoisomerase I inhibitor. T-2513 hydrochloride binds covalently to and stabilizes the topoisomerase I-DNA complex and inhibits DNA replication and RNA synthesis, ultimately leading to cell death[1]. |
| Name | T-2513 hydrochloride |
|---|
| Description | T-2513 hydrochloride is a selective topoisomerase I inhibitor. T-2513 hydrochloride binds covalently to and stabilizes the topoisomerase I-DNA complex and inhibits DNA replication and RNA synthesis, ultimately leading to cell death[1]. |
|---|---|
| Related Catalog | |
| Target |
Topoisomerase I |
| In Vitro | SN-38 is the metabolite of T-2513 hydrochloride[1]. T-2513 hydrochloride has a broad cytotoxicity against a range of human tumor cell lines[2]. Cell Viability Assay[2] Cell Line: WiDr, HT-29, SK-BR-3, MKN-1, SK-LU-1, LX-1, KB, and HeLaS3 cells Concentration: 15.1-111.5 ng/mL Incubation Time: 24 hours Result: Exhibited cytotoxicity against a panel of human tumor cell lines with GI50s of 32.1, 97.6, 38.6, 15.6, 111.5, 15.1, 34.0, and 50.9 ng/mL for WiDr, HT-29, SK-BR-3, MKN-1, SK-LU-1, LX-1, KB, and HeLaS3 cells, respectively. |
| In Vivo | T-2513 hydrochloride (1-100 mg/kg) shows Antitumor Activity against Walker-256 carcinoma[2]. Animal Model: Rats bearing Walker-256 carcinoma[2] Dosage: 1, 10, and 100 mg/kg Administration: Result: The ED50 was 23 mg/kg. |
| References |
| Molecular Formula | C25H28ClN3O5 |
|---|---|
| Molecular Weight | 485.96 |
| InChIKey | MIZGPLODSZKVPX-UQIIZPHYSA-N |
| SMILES | CCc1c2c(nc3ccc(OCCCN)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC.Cl |
| Hazard Codes | Xi |
|---|