Ethyl 3-formyl-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 3-formyl-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 18450-27-6 | Molecular Weight | 217.22100 | |
| Density | 1.293g/cm3 | Boiling Point | 428.5ºC at 760mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | 186-188ºC | |
| MSDS | N/A | Flash Point | 212.9ºC | |
| Name | Ethyl 3-formyl-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 428.5ºC at 760mmHg |
| Melting Point | 186-188ºC |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 212.9ºC |
| Exact Mass | 217.07400 |
| PSA | 59.16000 |
| LogP | 2.15710 |
| Vapour Pressure | 1.51E-07mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | UHTMDXSOGQARCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1C=O |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-formyl-1H-indole-2-carboxylate |