3-Formyl-1H-indole-2-carboxylic acid
Modify Date: 2025-09-12 12:42:40
3-Formyl-1H-indole-2-carboxylic acid structure
|
Common Name | 3-Formyl-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 28737-34-0 | Molecular Weight | 189.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Formyl-1H-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H7NO3 |
|---|---|
| Molecular Weight | 189.16700 |
| Exact Mass | 189.04300 |
| PSA | 70.16000 |
| LogP | 1.67860 |
| InChIKey | PRFDLSPESODVAW-UHFFFAOYSA-N |
| SMILES | O=Cc1c(C(=O)O)[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~83%
3-Formyl-1H-ind... CAS#:28737-34-0 |
| Literature: Font, M.; Monge, A.; Cuartero, A.; Ellorriaga, A.; Martinez-Irujo, J.J.; et al. European Journal of Medicinal Chemistry, 1995 , vol. 30, # 12 p. 963 - 972 |
|
~%
3-Formyl-1H-ind... CAS#:28737-34-0 |
| Literature: Fischer; Pistor Chemische Berichte, 1923 , vol. 56, p. 2317 |
|
~%
3-Formyl-1H-ind... CAS#:28737-34-0 |
| Literature: Fischer; Pistor Chemische Berichte, 1923 , vol. 56, p. 2317 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-Dimethylhydrazon des Indolaldehyds-3 |
| Indole-3-carboxaldehyde N,N-dimethylhydrazone |
| 3-formylindol-2-carboxylic acid |
| 1H-Indole-3-carboxaldehyde,dimethylhydrazone |
| 3-Formyl-indol-2-carbonsaeure |
| Indol-3-carbaldehyd-dimethylhydrazon |
| 3-formylindole N,N-dimethylhydrazone |
| indole-3-carbaldehyde dimethylhydrazone |
| 3-formyl-indole-2-carboxylic acid |