NH-bis(PEG3-t-butyl ester)
Modify Date: 2025-08-26 21:09:01
NH-bis(PEG3-t-butyl ester) structure
|
Common Name | NH-bis(PEG3-t-butyl ester) | ||
|---|---|---|---|---|
| CAS Number | 1814901-03-5 | Molecular Weight | 537.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H51NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NH-bis(PEG3-t-butyl ester)NH-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | NH-bis(PEG3-Boc) |
|---|---|
| Synonym | More Synonyms |
| Description | NH-bis(PEG3-Boc) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C26H51NO10 |
|---|---|
| Molecular Weight | 537.68 |
| InChIKey | JZUKFOGFKFISJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCNCCOCCOCCOCCC(=O)OC(C)(C)C |
| MFCD29912753 |