N-phenyl-1H-indole-2-carboxamide structure
|
Common Name | N-phenyl-1H-indole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 17954-05-1 | Molecular Weight | 236.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-phenyl-1H-indole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12N2O |
|---|---|
| Molecular Weight | 236.26900 |
| Exact Mass | 236.09500 |
| PSA | 48.38000 |
| LogP | 3.80420 |
| InChIKey | ARBMSJKZZZWLOE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1cc2ccccc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indole-2-carboxanilide |
| Indole,derivative of |
| N-phenyl-1H-2-indolecarboxamide |
| 1H-Indole-2-carboxamide,N-phenyl |
| indole-2-carboxylic acid anilide |
| N-phenylindole-2-carboxamide |