1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol structure
|
Common Name | 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol | ||
|---|---|---|---|---|
| CAS Number | 1707-77-3 | Molecular Weight | 262.299 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.0±32.0 °C at 760 mmHg | |
| Molecular Formula | C12H22O6 | Melting Point | 120-122 °C(lit.) | |
| MSDS | N/A | Flash Point | 184.8±25.1 °C | |
| Name | 1,2:5,6-Di-O-isopropylidene-D-mannitol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.0±32.0 °C at 760 mmHg |
| Melting Point | 120-122 °C(lit.) |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.299 |
| Flash Point | 184.8±25.1 °C |
| Exact Mass | 262.141632 |
| PSA | 77.38000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | ODYBCPSCYHAGHA-ZYUZMQFOSA-N |
| SMILES | CC1(C)OCC(C(O)C(O)C2COC(C)(C)O2)O1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Bis(2,2-Dimethyl-1,3-Dioxolan-4-yl)-1,2-Ethanediol |
| Diacetone Mannitol |
| Diacetone-D-Mannitol |
| D-Mannitol Diacetonide |
| (1S,2S)-1,2-Bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol (non-preferred name) |
| 1,2:5,6-Bis-O-(1-methylethylidene)-D-mannitol |
| 1,2:5,6-Di-O-isopropylidene-D- Mannitol |
| (1S,2S)-1,2-Bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-ethanediol |
| EINECS 216-954-8 |
| (1S,2S)-1,2-bis[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethane-1,2-diol |
| MFCD00003211 |