LW479
Modify Date: 2025-08-20 18:43:21
LW479 structure
|
Common Name | LW479 | ||
|---|---|---|---|---|
| CAS Number | 1688677-89-5 | Molecular Weight | 479.387 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H23BrN2O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of LW479LW479, a novel HDAC inhibitor, could be a candidate drug for breast cancer prevention. |
| Name | 6-{2-[2-(3-Bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]phenoxy}-N-hydroxyhexanamide |
|---|---|
| Synonym | More Synonyms |
| Description | LW479, a novel HDAC inhibitor, could be a candidate drug for breast cancer prevention. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H23BrN2O4S |
| Molecular Weight | 479.387 |
| Exact Mass | 478.056183 |
| LogP | 3.60 |
| Index of Refraction | 1.628 |
| InChIKey | XRAVVAITOQNASO-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCOc1ccccc1N1C(=O)CSC1c1cccc(Br)c1)NO |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H400 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | UN 3077 9 / PGIII |
| 6-{2-[2-(3-Bromophenyl)-4-oxo-1,3-thiazolidin-3-yl]phenoxy}-N-hydroxyhexanamide |
| Hexanamide, 6-[2-[2-(3-bromophenyl)-4-oxo-3-thiazolidinyl]phenoxy]-N-hydroxy- |