BMS-37
Modify Date: 2025-08-22 12:29:35
BMS-37 structure
|
Common Name | BMS-37 | ||
|---|---|---|---|---|
| CAS Number | 1675202-20-6 | Molecular Weight | 448.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BMS-37BMS-37 is a PD-1/PD-L1 immune checkpoint inhibitor. BMS-37 can be used as PD-L1 ligand to synthesize PROTAC molecules[1]. |
| Name | BMS-37 |
|---|
| Description | BMS-37 is a PD-1/PD-L1 immune checkpoint inhibitor. BMS-37 can be used as PD-L1 ligand to synthesize PROTAC molecules[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H32N2O4 |
|---|---|
| Molecular Weight | 448.55 |
| InChIKey | OYNIISWIMDFFAF-UHFFFAOYSA-N |
| SMILES | COc1cc(OCc2cccc(-c3ccccc3)c2C)cc(OC)c1CNCCNC(C)=O |