BMS-8 structure
|
Common Name | BMS-8 | ||
|---|---|---|---|---|
| CAS Number | 1675201-90-7 | Molecular Weight | 494.420 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 616.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H28BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.9±31.5 °C | |
Use of BMS-8BMS-8 inhibits the PD-1/PD-L1 interaction with IC50 of 7.2 μM. BMS-8, binds directly to PD-L1 and induces formation of PD-L1 homodimers, which in turn prevents the interaction with PD-1[1]. |
| Name | BMS-8 |
|---|---|
| Synonym | More Synonyms |
| Description | BMS-8 inhibits the PD-1/PD-L1 interaction with IC50 of 7.2 μM. BMS-8, binds directly to PD-L1 and induces formation of PD-L1 homodimers, which in turn prevents the interaction with PD-1[1]. |
|---|---|
| Related Catalog | |
| In Vitro | BMS-8 tends to have a more stable binding mode with one PD-L1 monomer than the other and the small-molecule inducing PD-L1 dimerization was further stabilized by the non-polar interaction of Ile54, Tyr56, Met115, Ala121, and Tyr123 on both monomers and the water bridges involved in ALys124[2]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 616.9±55.0 °C at 760 mmHg |
| Molecular Formula | C27H28BrNO3 |
| Molecular Weight | 494.420 |
| Flash Point | 326.9±31.5 °C |
| Exact Mass | 493.125244 |
| LogP | 6.28 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | QRXBPPWUGITQLE-UHFFFAOYSA-N |
| SMILES | Cc1c(COc2ccc(CN3CCCCC3C(=O)O)cc2Br)cccc1-c1ccccc1 |
| BMS-8 |
| 1-{3-Bromo-4-[(2-methyl-3-biphenylyl)methoxy]benzyl}-2-piperidinecarboxylic acid |
| 2-Piperidinecarboxylic acid, 1-[[3-bromo-4-[(2-methyl[1,1'-biphenyl]-3-yl)methoxy]phenyl]methyl]- |