erythrosin B structure
|
Common Name | erythrosin B | ||
|---|---|---|---|---|
| CAS Number | 16423-68-0 | Molecular Weight | 879.856 | |
| Density | 0.98 | Boiling Point | 693.2ºC at 760 mmHg | |
| Molecular Formula | C20H6I4Na2O5 | Melting Point | >300ºC (Decomposes) | |
| MSDS | Chinese USA | Flash Point | 373ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of erythrosin BErythrosin B is an artificial dye widely used in the food and textile industries. Erythrosin B is also a novel photosensitizer which has been used to develop animal models. |
| Name | erythrosin B |
|---|---|
| Synonym | More Synonyms |
| Description | Erythrosin B is an artificial dye widely used in the food and textile industries. Erythrosin B is also a novel photosensitizer which has been used to develop animal models. |
|---|---|
| Related Catalog | |
| In Vitro | Only the two highest concentrations of Erythrosin B tested (50.0 and 70.0 μg/mL) are significantly different (p<0.05) from the vehicle control group when the Tail Moment and Tail Intensity, which represent the extent of DNA damage, are analyzed. Results show increased micronuclei (MNi) frequencies at six of the seven Erythrosin B concentrations (0.2 to 70.0 μg/mL) when compare to vehicle control group[1]. |
| Cell Assay | The alkaline single-cell gel electrophoresis assay (comet assay) is performed. Briefly, 2×105 HepG2 cells are seeded in a 24-well plate for 24 h. The cells are then treated with Erythrosin B at 0.1, 0.2, 2.0, 10.0, 25.0, 50.0 or 70.0 μg/mL (final concentration) for 4 h; vehicle control (0.7% DMSO) and positive control (doxorubicin0.3 μg/mL) treatments are also performed. The HepG2 cell suspension is mixed with 37°C low-melting point agarose and transferred to normal-melting point agarose-coated slides. One hundred randomly chosen nucleoids are analyzed per treatment, and a total of three independent experiments are performed[1]. |
| References |
| Density | 0.98 |
|---|---|
| Boiling Point | 693.2ºC at 760 mmHg |
| Melting Point | >300ºC (Decomposes) |
| Molecular Formula | C20H6I4Na2O5 |
| Molecular Weight | 879.856 |
| Flash Point | 373ºC |
| Exact Mass | 879.618896 |
| PSA | 81.65000 |
| LogP | 6.96060 |
| Vapour Pressure | 2.22E-16mmHg at 25°C |
| InChIKey | RAGZEDHHTPQLAI-UHFFFAOYSA-L |
| SMILES | O=C1OC2(c3ccccc31)c1cc(I)c([O-])c(I)c1Oc1c2cc(I)c([O-])c1I.[Na+].[Na+] |
| Storage condition | Store at +5°C to +30°C. |
| Water Solubility | 100g/l |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H413 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | LM5950000 |
| HS Code | 32129000 |
|
Gold(I) complexes of 9-deazahypoxanthine as selective antitumor and anti-inflammatory agents.
PLoS ONE 9(10) , e109901, (2014) The gold(I) mixed-ligand complexes involving O-substituted derivatives of 9-deazahypoxanthine (HLn) and triphenylphosphine (PPh3) with the general formula [Au(Ln)(PPh3)] (1-5) were prepared and thorou... |
|
|
Evaluation of potential genotoxicity of five food dyes using the somatic mutation and recombination test.
Chemosphere 88(8) , 974-9, (2012) In this study, different concentrations of five food dyes (amaranth, patent blue, carminic acid, indigotine and erythrosine) have been evaluated for genotoxicity in the Somatic Mutation and Recombinat... |
|
|
Hypoxia enhances proliferation and stemness of human adipose-derived mesenchymal stem cells.
Cytotechnology 67 , 1073-84, (2015) The aim of the study was to obtain the highest number of multipotent adipose-derived mesenchymal stem cells (ADMSCs) by using culture conditions which favour cell expansion without loss of mesenchymal... |
| 1427red |
| Erythrosin B,high purity,biological stain |
| Erythrosin |
| Tetraiodofluorescein sodium salt |
| Erythrosine Sodium (close form) |
| Disodium 2-(2,4,5,7-tetraiodo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
| Benzoic acid, 2-(6-hydroxy-2,4,5,7-tetraiodo-3-oxo-3H-xanthen-9-yl)-, sodium salt (1:2) |
| 2',4',5',7'-Tetraiodofluorescein disodium salt |
| Erythrosin extra bluish |
| IODOEOSIN |
| FD & C Red 3 |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-dihydroxy-2',4',5',7'-tetraiodo-, sodium salt (1:2) |
| EINECS 240-474-8 |
| 3',6'-Dihydroxy-2',4',5',7'-tetraiodospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one Disodium Salt |
| FDC red no. 3 |
| Disodium 2',4',5',7'-tetraiodo-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| Sodium 2',4',5',7'-tetraiodo-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-3',6'-bis(olate) |
| 1671red |
| Food Red No. 3 |
| c.i.773 |
| Japan Red 3 |
| EOSIN J |
| FD and C Red No. 3 |
| Synerid |
| MFCD00144257 |
| fdcred3 |
| CRED3 |
| ebs |
| Ceplac |
| Erythrosin B,certified |
| lb-rot1 |
| Erythrosin B |
| Acid Red 51 |