Hexapeptide-11
Modify Date: 2025-08-25 15:11:47
Hexapeptide-11 structure
|
Common Name | Hexapeptide-11 | ||
|---|---|---|---|---|
| CAS Number | 161258-30-6 | Molecular Weight | 676.80200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H48N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hexapeptide-11Hexapeptide-11 is a bioactive peptide with anti-aging effect. Hexapeptide-11 protects fibroblasts against oxidative stress-mediated premature cellular senescence by mediating a downregulation of cellular proteins, such as ataxia telangiectasia mutated (ATM) and p53 [1]. |
| Name | (2S)-1-[(2S)-2-[[(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutanoyl]amino]propanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Hexapeptide-11 is a bioactive peptide with anti-aging effect. Hexapeptide-11 protects fibroblasts against oxidative stress-mediated premature cellular senescence by mediating a downregulation of cellular proteins, such as ataxia telangiectasia mutated (ATM) and p53 [1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H48N6O7 |
|---|---|
| Molecular Weight | 676.80200 |
| Exact Mass | 676.35800 |
| PSA | 201.71000 |
| LogP | 4.09300 |
| InChIKey | GFEYWOGCSROPRT-OBXVVNIGSA-N |
| SMILES | CC(NC(=O)C(NC(=O)C(N)Cc1ccccc1)C(C)C)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| L-Proline,L-phenylalanyl-L-valyl-L-alanyl-L-prolyl-L-phenylalanyl |
| Hexapeptide-11 |