WAY-312187 structure
|
Common Name | WAY-312187 | ||
|---|---|---|---|---|
| CAS Number | 1609385-99-0 | Molecular Weight | 283.28 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 555.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.7±30.1 °C | |
Use of WAY-312187Pim-1 kinase inhibitors |
| Name | WAY-312187 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 555.4±50.0 °C at 760 mmHg |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 |
| Flash Point | 289.7±30.1 °C |
| Exact Mass | 283.084473 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | INXITDUVMMOWQZ-BQYQJAHWSA-N |
| SMILES | O=C(C=Cc1ccco1)CC1(O)C(=O)Nc2ccccc21 |
| MFCD02188089 |
| 2H-Indol-2-one, 3-[(3E)-4-(2-furanyl)-2-oxo-3-buten-1-yl]-1,3-dihydro-3-hydroxy- |
| 3-[(3E)-4-(2-Furyl)-2-oxo-3-buten-1-yl]-3-hydroxy-1,3-dihydro-2H-indol-2-one |
| 3-[(3E)-4-(2-Furyl)-2-oxobut-3-en-1-yl]-3-hydroxy-1,3-dihydro-2H-indol-2-one |