BTK-IN-20 structure
|
Common Name | BTK-IN-20 | ||
|---|---|---|---|---|
| CAS Number | 1581714-50-2 | Molecular Weight | 539.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H30FN7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BTK-IN-20BTK-IN-20 (compound 283) is a BTK tyrosine kinase inhibitor and a 1H-pyrazolo[3,4-d]pyrimidine derivative. BTK-IN-20 can be used for the research of cancer and inflammation[1]. |
| Name | BTK-IN-20 |
|---|
| Description | BTK-IN-20 (compound 283) is a BTK tyrosine kinase inhibitor and a 1H-pyrazolo[3,4-d]pyrimidine derivative. BTK-IN-20 can be used for the research of cancer and inflammation[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H30FN7O2 |
|---|---|
| Molecular Weight | 539.60 |
| InChIKey | KZMQPYCXSAGLTB-RMWKRFJVSA-N |
| SMILES | CC(C)(C)C=C(C#N)C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3F)c3c(N)ncnc32)C1 |