OS-3-106 structure
|
Common Name | OS-3-106 | ||
|---|---|---|---|---|
| CAS Number | 1580000-17-4 | Molecular Weight | 450.60 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 671.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H30N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 359.8±31.5 °C | |
Use of OS-3-106OS-3-106 is a potent, BBB-penetrated and selective dopamine D3 receptor (D3R) agonist. OS-3-106 binds with high affinity (Ki = 0.2 nM) at the D3R. OS-3-106 reduces cocaine self-administration and sucrose reinforcement rates. OS-3-106 can be used for psychostimulant addiction research[1]. |
| Name | N-{4-[4-(2-Methoxyphenyl)-1-piperazinyl]butyl}-4-(1,3-thiazol-4-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | OS-3-106 is a potent, BBB-penetrated and selective dopamine D3 receptor (D3R) agonist. OS-3-106 binds with high affinity (Ki = 0.2 nM) at the D3R. OS-3-106 reduces cocaine self-administration and sucrose reinforcement rates. OS-3-106 can be used for psychostimulant addiction research[1]. |
|---|---|
| Related Catalog | |
| Target |
D3 Receptor:0.2 nM (Ki) D2 Receptor |
| In Vitro | OS-3-106 exhibits 115-fold binding selectivity for the D3R compared with the D2R[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 671.3±55.0 °C at 760 mmHg |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.60 |
| Flash Point | 359.8±31.5 °C |
| Exact Mass | 450.208954 |
| LogP | 4.10 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | RGWFVVKSJUSKTE-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCN(CCCCNC(=O)c2ccc(-c3cscn3)cc2)CC1 |
| MFCD28118985 |
| N-{4-[4-(2-Methoxyphenyl)-1-piperazinyl]butyl}-4-(1,3-thiazol-4-yl)benzamide |
| Benzamide, N-[4-[4-(2-methoxyphenyl)-1-piperazinyl]butyl]-4-(4-thiazolyl)- |