N-Trifluoroacetyl-L-cysteine methyl ester
Modify Date: 2025-10-27 20:03:46
N-Trifluoroacetyl-L-cysteine methyl ester structure
|
Common Name | N-Trifluoroacetyl-L-cysteine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1577-62-4 | Molecular Weight | 231.19300 | |
| Density | 1.377g/cm3 | Boiling Point | 272.7ºC at 760mmHg | |
| Molecular Formula | C6H8F3NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.7ºC | |
| Name | N-Trifluoroacetyl-L-cysteine methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 272.7ºC at 760mmHg |
| Molecular Formula | C6H8F3NO3S |
| Molecular Weight | 231.19300 |
| Flash Point | 118.7ºC |
| Exact Mass | 231.01800 |
| PSA | 94.20000 |
| LogP | 0.52720 |
| Vapour Pressure | 0.00598mmHg at 25°C |
| Index of Refraction | 1.432 |
| InChIKey | VWGSQMAKRLENER-VKHMYHEASA-N |
| SMILES | COC(=O)C(CS)NC(=O)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2930909090 |
|
~%
N-Trifluoroacet... CAS#:1577-62-4 |
| Literature: Tan, Karen Co; Wakimoto, Toshiyuki; Takada, Kentaro; Ohtsuki, Takashi; Uchiyama, Nahoko; Goda, Yukihiro; Abe, Ikuro Journal of Natural Products, 2013 , vol. 76, # 7 p. 1388 - 1391 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-TFA-Cys-OCH3 |