Pomalidomide-5-OH
Modify Date: 2025-08-27 16:58:48
Pomalidomide-5-OH structure
|
Common Name | Pomalidomide-5-OH | ||
|---|---|---|---|---|
| CAS Number | 1547162-41-3 | Molecular Weight | 289.24 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 633.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.6±31.5 °C | |
Use of Pomalidomide-5-OHPomalidomide-5-OH (5-hydroxy pomalidomide) is the Pomalidomide-based cereblon (CRBN) ligand used in the recruitment of CRBN protein. Pomalidomide-5-OH can be connected to the ligand for protein by a linker to form PROTAC[1]. |
| Name | CC-17368 |
|---|---|
| Synonym | More Synonyms |
| Description | Pomalidomide-5-OH (5-hydroxy pomalidomide) is the Pomalidomide-based cereblon (CRBN) ligand used in the recruitment of CRBN protein. Pomalidomide-5-OH can be connected to the ligand for protein by a linker to form PROTAC[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 633.0±55.0 °C at 760 mmHg |
| Molecular Formula | C13H11N3O5 |
| Molecular Weight | 289.24 |
| Flash Point | 336.6±31.5 °C |
| Exact Mass | 289.069885 |
| LogP | -1.24 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.725 |
| InChIKey | MVWWLCCKVBTYTD-UHFFFAOYSA-N |
| SMILES | Nc1c(O)ccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Storage condition | 2-8°C |
| 4-Amino-2-(2,6-dioxo-3-piperidinyl)-5-hydroxy-1H-isoindole-1,3(2H)-dione |
| CC-17368 |
| MFCD32199595 |
| 1H-Isoindole-1,3(2H)-dione, 4-amino-2-(2,6-dioxo-3-piperidinyl)-5-hydroxy- |
| 2JD83JK9RC |
| UNII:2JD83JK9RC |