(4-Fluorophenyl)(1H-indol-3-yl)methanone structure
|
Common Name | (4-Fluorophenyl)(1H-indol-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 152807-26-6 | Molecular Weight | 239.244 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 428.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C15H10FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.0±23.2 °C | |
| Name | (4-fluorophenyl)-(1H-indol-3-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.7±25.0 °C at 760 mmHg |
| Molecular Formula | C15H10FNO |
| Molecular Weight | 239.244 |
| Flash Point | 213.0±23.2 °C |
| Exact Mass | 239.074646 |
| PSA | 32.86000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | VWIPMQNJODLVFA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)c1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~85%
(4-Fluorophenyl... CAS#:152807-26-6 |
| Literature: Jiang, Tao-Shan; Wang, Guan-Wu Organic Letters, 2013 , vol. 15, # 4 p. 788 - 791 |
|
~21%
(4-Fluorophenyl... CAS#:152807-26-6 |
| Literature: Le Borgne, Marc; Marchand, Pascal; Delevoye-Seiller, Benedicte; Robert, Jean-Michel; Le Baut, Guillaume; Hartmann, Rolf W.; Palzer, Martina Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 3 p. 333 - 336 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-Fluorophenyl)(1H-indol-3-yl)methanone |
| 3-(4'-Fluorobenzoyl)indole |
| Methanone, (4-fluorophenyl)-1H-indol-3-yl- |