(4-Fluorophenyl)(2-methyl-1H-indol-3-yl)methanone
Modify Date: 2025-08-22 00:08:12
(4-Fluorophenyl)(2-methyl-1H-indol-3-yl)methanone structure
|
Common Name | (4-Fluorophenyl)(2-methyl-1H-indol-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 26206-00-8 | Molecular Weight | 253.271 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 408.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C16H12FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.0±25.9 °C | |
| Name | (4-fluorophenyl)-(2-methyl-1H-indol-3-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.8±35.0 °C at 760 mmHg |
| Molecular Formula | C16H12FNO |
| Molecular Weight | 253.271 |
| Flash Point | 201.0±25.9 °C |
| Exact Mass | 253.090286 |
| PSA | 32.86000 |
| LogP | 3.79 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | YLQSMBXRBZJCHM-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)c1ccc(F)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
(4-Fluorophenyl... CAS#:26206-00-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 34, # 3 p. 1099 - 1110 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methanone, (4-fluorophenyl)(2-methyl-1H-indol-3-yl)- |
| AC-6742 |
| 2-Methyl-3-(4'-fluorobenzoyl)indole |
| (4-Fluorophenyl)(2-methyl-1H-indol-3-yl)methanone |