sulfo-NHS-acetate structure
|
Common Name | sulfo-NHS-acetate | ||
|---|---|---|---|---|
| CAS Number | 152305-87-8 | Molecular Weight | 237.18700 | |
| Density | 1.8g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H7NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of sulfo-NHS-acetateSulfo-NHS-Acetate is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-acetyloxy-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfo-NHS-Acetate is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.8g/cm3 |
|---|---|
| Molecular Formula | C6H7NO7S |
| Molecular Weight | 237.18700 |
| Exact Mass | 236.99400 |
| PSA | 126.43000 |
| Index of Refraction | 1.583 |
| InChIKey | MDUQWFYJHRLNRN-UHFFFAOYSA-N |
| SMILES | CC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Sulfo-nhs-acetate |
| BIM103 |
| Sulfosuccinimidyl acetate |
| 3-Pyrrolidinesulfonicacid,1-(acetyloxy)-2,5-dioxo |
| 1-Acetoxy-2,5-dioxopyrrolidine-3-sulfonic acid |