N-[(Benzyloxy)carbonyl]norleucine structure
|
Common Name | N-[(Benzyloxy)carbonyl]norleucine | ||
|---|---|---|---|---|
| CAS Number | 15027-14-2 | Molecular Weight | 265.305 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 449.2±38.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | 56-58ºC | |
| MSDS | N/A | Flash Point | 225.5±26.8 °C | |
Use of N-[(Benzyloxy)carbonyl]norleucineCbz-D-norleucine (Z-D-NLE-OH) is a derivative of norleucine, can be used for preparing drugs or other compounds[1]. |
| Name | (2R)-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-D-norleucine (Z-D-NLE-OH) is a derivative of norleucine, can be used for preparing drugs or other compounds[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.2±38.0 °C at 760 mmHg |
| Melting Point | 56-58ºC |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.305 |
| Flash Point | 225.5±26.8 °C |
| Exact Mass | 265.131409 |
| PSA | 75.63000 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | NMYWMOZOCYAHNC-GFCCVEGCSA-N |
| SMILES | CCCCC(NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | Store at RT. |
|
~87%
N-[(Benzyloxy)c... CAS#:15027-14-2 |
| Literature: Synthetic Communications, , vol. 18, # 4 p. 441 - 444 |
|
~%
N-[(Benzyloxy)c... CAS#:15027-14-2 |
| Literature: Journal of the American Chemical Society, , vol. 118, # 10 p. 2332 - 2339 |
|
~%
N-[(Benzyloxy)c... CAS#:15027-14-2 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 3 p. 417 - 419 |
|
~%
N-[(Benzyloxy)c... CAS#:15027-14-2 |
| Literature: Journal of Organic Chemistry, , vol. 50, # 3 p. 417 - 419 |
|
~%
Detail
|
| Literature: Synlett, , vol. 1997, # 6 p. 659 - 660 |
|
~%
N-[(Benzyloxy)c... CAS#:15027-14-2 |
| Literature: Chemistry Letters, , p. 1125 - 1128 |
|
~%
N-[(Benzyloxy)c... CAS#:15027-14-2 |
| Literature: Roczniki Chemii, , vol. 40, p. 1665 - 1673 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzyloxycarbonyl-DL-norleucine |
| Cbz-D-norleucine |
| carbobenzoxyaminocaproic acid |
| Z-DL-norleucine |
| N-Carbobenzoxy-DL-norleucine |
| Z-D-Nle-OH |
| N-Benzyloxycarbonyl-D-norleucine |
| N-Cbz-(D,L)-norleucine |
| Cbz-DL-norleucine |
| N-[(Benzyloxy)carbonyl]norleucine |
| DL-Z-Nor-Leu-OH |
| Z-DL-Nle-OH |
| N-benzyloxycarbonylnorleucine |
| DL-CBZ-Norleucine |
| Z-D-norleucine |
| Norleucine, N-[(phenylmethoxy)carbonyl]- |
| D-Z-Nor-Leu-OH |
| MFCD00063169 |
| N-Benzyloxycarbonyl-DL-norleucin |
| N-Cbz-DL-norleucine |