4-(Benzyloxy)benzoic acid structure
|
Common Name | 4-(Benzyloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1486-51-7 | Molecular Weight | 228.243 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 396.3±17.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | 189-192 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 152.3±14.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-benzyloxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 396.3±17.0 °C at 760 mmHg |
| Melting Point | 189-192 °C(lit.) |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.243 |
| Flash Point | 152.3±14.4 °C |
| Exact Mass | 228.078644 |
| PSA | 46.53000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | AQSCHALQLXXKKC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCc2ccccc2)cc1 |
| Storage condition | 2~8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;Xi: Irritant; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Preliminary evaluation of anticonvulsant activity of some 4-(benzyloxy)-benzamides.
Acta Pol. Pharm. 60(6) , 477-80, (2003) A series of alkanolamides have been tested for anticonvulsant activity in the maximal electroshock seizure (MES) and subcutaneous pentylenetetrazole seizure treshold (ScMet) assays and for neurotoxici... |
|
|
Semi-synthesis and proteasome inhibition of D-ring deoxy analogs of (-)-epigallocatechin gallate (EGCG), the active ingredient of green tea extract. Huo C, et al.
Can. J. Chem. 86(6) , 495-502, (2008)
|
|
|
Synthesis and characterization of achiral banana-shaped liquid crystalline molecules containing bisnaphthyl moieties. Yang PJ and Lin HC.
Liq. Cryst. 33(5) , 587-603, (2006)
|
| EINECS 216-066-0 |
| 4-Benzyloxybenzoic acid |
| 4-phenylmethoxybenzoic acid |
| Benzoic acid, 4-(phenylmethoxy)- |
| 4-(Benzyloxy)benzoic acid |
| 4-benzyloxy benzoic acid |
| MFCD00016527 |