Octyl paraben structure
|
Common Name | Octyl paraben | ||
|---|---|---|---|---|
| CAS Number | 1219-38-1 | Molecular Weight | 250.33300 | |
| Density | 1.037g/cm3 | Boiling Point | 368.1ºC at 760 mmHg | |
| Molecular Formula | C15H22O3 | Melting Point | 52-53ºC | |
| MSDS | N/A | Flash Point | 147.6ºC | |
| Name | Octyl Paraben |
|---|---|
| Synonym | More Synonyms |
| Density | 1.037g/cm3 |
|---|---|
| Boiling Point | 368.1ºC at 760 mmHg |
| Melting Point | 52-53ºC |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33300 |
| Flash Point | 147.6ºC |
| Exact Mass | 250.15700 |
| PSA | 46.53000 |
| LogP | 3.90950 |
| Vapour Pressure | 6.15E-06mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | RIKCMEDSBFQFAL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1ccc(O)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RTECS | DH2529050 |
| HS Code | 2918290000 |
|
~95%
Octyl paraben CAS#:1219-38-1 |
| Literature: Synthetic Communications, , vol. 41, # 7 p. 945 - 952 |
|
~%
Octyl paraben CAS#:1219-38-1 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 52, # 10 p. 3177 - 3181 |
|
~%
Octyl paraben CAS#:1219-38-1 |
| Literature: Journal of Agricultural and Food Chemistry, , vol. 52, # 10 p. 3177 - 3181 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Hydroxybenzoic Acid n-Octyl Ester |
| n-Octyl 4-Hydroxybenzoate |
| MFCD00016482 |
| EINECS 214-943-2 |
| n-Octylparaben |
| octyl 4-hydroxybenzoate |