(S)-4-N-Boc-2-methylpiperazine structure
|
Common Name | (S)-4-N-Boc-2-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 147081-29-6 | Molecular Weight | 200.28 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 268.7±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O2 | Melting Point | 40-45ºC | |
| MSDS | Chinese USA | Flash Point | 116.3±20.4 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
Use of (S)-4-N-Boc-2-methylpiperazine(S)-1-Boc-3-methylpiperazine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | (S)-4-N-Boc-2-methylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-1-Boc-3-methylpiperazine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.7±15.0 °C at 760 mmHg |
| Melting Point | 40-45ºC |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 |
| Flash Point | 116.3±20.4 °C |
| Exact Mass | 200.152481 |
| PSA | 41.57000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.459 |
| InChIKey | FMLPQHJYUZTHQS-QMMMGPOBSA-N |
| SMILES | CC1CN(C(=O)OC(C)(C)C)CCN1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R37/38;R41 |
| Safety Phrases | S26-S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~82%
(S)-4-N-Boc-2-m... CAS#:147081-29-6 |
| Literature: US2008/76758 A1, ; Page/Page column 88 ; US 20080076758 A1 |
|
~%
(S)-4-N-Boc-2-m... CAS#:147081-29-6 |
| Literature: WO2004/52887 A2, ; Page 31 ; |
|
~92%
(S)-4-N-Boc-2-m... CAS#:147081-29-6 |
| Literature: US2003/153556 A1, ; US 20030153556 A1 |
|
~%
(S)-4-N-Boc-2-m... CAS#:147081-29-6 |
| Literature: WO2004/96810 A1, ; Page 171 ; |
|
~%
(S)-4-N-Boc-2-m... CAS#:147081-29-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 24 p. 6017 - 6021 |
|
~%
(S)-4-N-Boc-2-m... CAS#:147081-29-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 44, # 21 p. 3343 - 3346 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02683204 |
| tert-butyl (3S)-3-methylpiperazine-1-carboxylate |
| tert-Butyl (S)-3-methyl-1-piperazinecarboxylate |
| (S)-(-)-1-Boc-3-methylpiperazine |
| (S)-1-Boc-3-methylpiperazine |