Lactoferricin B25 trifluoroacetate salt
Modify Date: 2025-09-04 17:51:02
Lactoferricin B25 trifluoroacetate salt structure
|
Common Name | Lactoferricin B25 trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 146897-68-9 | Molecular Weight | 3123.77 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 288.2±33.0 °C at 760 mmHg | |
| Molecular Formula | C141H224N46O29S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.1±25.4 °C | |
Use of Lactoferricin B25 trifluoroacetate saltLactoferrin 17-41, known as lactoferricin B (LfcinB), corresponds to residues 17-41 of bovine lactoferrin, has antimicrobial and antitumor activities[1][2]. |
| Name | Lactoferricin B |
|---|---|
| Synonym | More Synonyms |
| Description | Lactoferrin 17-41, known as lactoferricin B (LfcinB), corresponds to residues 17-41 of bovine lactoferrin, has antimicrobial and antitumor activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.2±33.0 °C at 760 mmHg |
| Molecular Formula | C141H224N46O29S3 |
| Molecular Weight | 3123.77 |
| Flash Point | 128.1±25.4 °C |
| Exact Mass | 218.065979 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | CSSYQJWUGATIHM-IKGCZBKSSA-N |
| SMILES | CCC(C)C(NC(=O)C(CO)NC(=O)C1CCCN1C(=O)C(C)NC(=O)CNC(=O)C(CC(C)C)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(CCSC)NC(=O)C(CCCNC(=N)N)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(N)=O)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCNC(=N)N)NC(=O)C(CS)NC(=O)C(CCCCN)NC(=O)C(N)Cc1ccccc1)C(=O)NC(C(=O)NC(CS)C(=O)NC(C(=O)NC(CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)O)C(C)C)C(C)O |
| Storage condition | 2-8℃ |
| Safety Phrases | 22-24/25 |
|---|
| Lactoferricin |
| N-Methylthiocarbamoyl-N'-[(1-methylallyl)thiocarbamoyl]hydrazine |
| N-(3-Buten-2-yl)-N'-methyl-1,2-hydrazinedicarbothioamide |
| 1,2-Hydrazinedicarbothioamide, N-methyl-N-(1-methyl-2-propen-1-yl)- |
| metallibure |
| Methallibure |
| MONL 03 |