WAY-620929
Modify Date: 2025-08-26 15:06:46
WAY-620929 structure
|
Common Name | WAY-620929 | ||
|---|---|---|---|---|
| CAS Number | 146381-57-9 | Molecular Weight | 305.4 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 472.6±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H19N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6±31.5 °C | |
Use of WAY-620929inhibitor of NADPH-oxidase; Myeloperoxidase (MPO) inhibitor; altering the lifespan of a eukaryotic organism; |
| Name | WAY-620929 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.6±55.0 °C at 760 mmHg |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.4 |
| Flash Point | 239.6±31.5 °C |
| Exact Mass | 305.119812 |
| LogP | 0.92 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | WGDJVNHECFFQHH-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1CCCN1CCOCC1 |
| 2-mercapto-3-(3-morpholin-4-ylpropyl)quinazolin-4(3H)-one |
| 4(1H)-Quinazolinone, 2,3-dihydro-3-[3-(4-morpholinyl)propyl]-2-thioxo- |
| MFCD04627359 |
| 4(3H)-quinazolinone, 2-mercapto-3-[3-(4-morpholinyl)propyl]- |
| 3-(3-morpholinopropyl)-2-thioxo-2,3-dihydro-4(1H)-quinazolinone |
| MFCD03867371 |
| 3-[3-(4-Morpholinyl)propyl]-2-thioxo-2,3-dihydro-4(1H)-quinazolinone |