INT structure
|
Common Name | INT | ||
|---|---|---|---|---|
| CAS Number | 146-68-9 | Molecular Weight | 505.696 | |
| Density | N/A | Boiling Point | 567.5ºC at 760 mmHg | |
| Molecular Formula | C19H13ClIN5O2 | Melting Point | 240 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 297ºC | |
| Symbol |
GHS08 |
Signal Word | Warning | |
Use of INTINT(Iodonitrotetrazolium chloride) is used in various dehydrogenase colorimetric analysis of the electron acceptor. |
| Name | iodonitrotetrazolium chloride |
|---|---|
| Synonym | More Synonyms |
| Description | INT(Iodonitrotetrazolium chloride) is used in various dehydrogenase colorimetric analysis of the electron acceptor. |
|---|---|
| Related Catalog |
| Boiling Point | 567.5ºC at 760 mmHg |
|---|---|
| Melting Point | 240 °C (dec.)(lit.) |
| Molecular Formula | C19H13ClIN5O2 |
| Molecular Weight | 505.696 |
| Flash Point | 297ºC |
| Exact Mass | 504.980225 |
| PSA | 80.41000 |
| LogP | 1.25100 |
| Vapour Pressure | 6.76E-13mmHg at 25°C |
| InChIKey | JORABGDXCIBAFL-UHFFFAOYSA-M |
| SMILES | O=[N+]([O-])c1ccc(-[n+]2nc(-c3ccccc3)nn2-c2ccc(I)cc2)cc1.[Cl-] |
| Storage condition | Store at 2-8 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | soluble |
| Symbol |
GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H371 |
| Precautionary Statements | P260 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | F:Flammable;Xn:Harmful; |
| Risk Phrases | R11;R20/21/22;R36/37/38 |
| Safety Phrases | S36/37-S36/37/39-S26-S22-S16 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2933990090 |
|
~%
INT CAS#:146-68-9 |
| Literature: Journal of the American Chemical Society, , vol. 72, p. 3629 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
MAPK15 mediates BCR-ABL1-induced autophagy and regulates oncogene-dependent cell proliferation and tumor formation.
Autophagy 11 , 1790-802, (2015) A reciprocal translocation of the ABL1 gene to the BCR gene results in the expression of the oncogenic BCR-ABL1 fusion protein, which characterizes human chronic myeloid leukemia (CML), a myeloprolife... |
|
|
Investigating the potential of under-utilised plants from the Asteraceae family as a source of natural antimicrobial and antioxidant extracts.
Food Chem. 161 , 79-86, (2014) Antimicrobial properties of ethanol and water extracts from eight Asteraceae species were investigated against three Gram positive (Staphylococcus aureus, MRSA and Bacillus cereus) and two Gram negati... |
|
|
Neuraminidase inhibitory activities of quaternary isoquinoline alkaloids from Corydalis turtschaninovii rhizome.
Bioorg. Med. Chem. 22(21) , 6047-52, (2014) Clostridium perfringens is a Gram-positive spore-forming bacterium that causes food poisoning. The neuraminidase (NA) protein of C. perfringens plays a pivotal role in bacterial proliferation and is c... |
| IODONITROTETRAZOLIUM CHLORIDE |
| IntA.R. |
| 2-(4-iodophenyl)-3-(4-nitrophenyl)-5-phenyl-3H-tetrazol-2-ium chloride |
| 4-IODONITROTETRAZOLIUM VIOLET |
| 2-(4-Iodophenyl)-3-(4-nitrophenyl)-5-phenyltetrazoliuM Chloride |
| 2-(4-idophenyl)-3-(4-nitrophenyl)-5-phenyl-2H-tetrazoliumchloride |
| 2-(4-iodo-phenyl)-3-(4-nitro-phenyl)-5-phenyl-tetrazolium,chloride |
| 2H-Tetrazolium, 3-(4-iodophenyl)-2-(4-nitrophenyl)-5-phenyl-, chloride (1:1) |
| 2-(4-Jod-phenyl)-3-(4-nitro-phenyl)-5-phenyl-tetrazolium,Chlorid |
| P-IODONITROTETRAZOLIUM VIOLET |
| INT CHLORIDE |
| MFCD00011961 |
| INT |
| Iodonitrotetrazolium purple |
| INT DYE |
| Iodonitrotetrazolium chloride (INT) |
| 3-(4-Iodophenyl)-2-(4-nitrophenyl)-5-phenyl-2H-tetrazol-3-ium chloride |
| IODONITROTETRAZOLIUM VIOLET |
| 2-(p-iodophenyl)-3(p-nitrophenyl)-5-phenyl tetrazolium chloride |
| EINECS 205-676-2 |
| IODONITROTETRAZOLIUM |
| 2-(4-Iodophenyl)-3-(4-nitrophenyl)-5-phenyltetrazolium Chloride. Iodonitrotetrazolium chloride |