Compound A structure
|
Common Name | Compound A | ||
|---|---|---|---|---|
| CAS Number | 14593-25-0 | Molecular Weight | 264.14800 | |
| Density | N/A | Boiling Point | 324.6ºC at 760 mmHg | |
| Molecular Formula | C11H15Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.1ºC | |
| Name | [4-[1-chloro-2-(methylamino)ethyl]phenyl] acetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 324.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.14800 |
| Flash Point | 150.1ºC |
| Exact Mass | 263.04800 |
| PSA | 38.33000 |
| LogP | 3.30410 |
| Vapour Pressure | 0.000243mmHg at 25°C |
| InChIKey | WKMYTPCPAWZWII-UHFFFAOYSA-N |
| SMILES | CNCC(Cl)c1ccc(OC(C)=O)cc1.Cl |
| HS Code | 2922199090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Acetoxy-4-(1-chlor-2-methylamino-aethyl)-benzol,Hydrochlorid |
| 2-(4-acetoxyphenyl)-2-chloro-N-methylammonium chloride |
| 1-acetoxy-4-(1-chloro-2-methylamino-ethyl)-benzene,hydrochloride |
| Glucocorticoid Receptor Modulator,CpdA |
| 4-[1-CHLORO-2-(METHYLAMINO)ETHYL]PHENYL ACETATE HYDROCHLORIDE |
| 2-(4-acetoxyphenyl)-2-chloro-N-methyl-ethylammonium chloride |