Propargyl-PEG2-Tos
Modify Date: 2025-08-26 17:02:17
Propargyl-PEG2-Tos structure
|
Common Name | Propargyl-PEG2-Tos | ||
|---|---|---|---|---|
| CAS Number | 145916-41-2 | Molecular Weight | 254.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Propargyl-PEG2-TosPropargyl-PEG2-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-(prop-2-yn-1-yloxy)ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Propargyl-PEG2-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H14O4S |
|---|---|
| Molecular Weight | 254.30200 |
| Exact Mass | 254.06100 |
| PSA | 60.98000 |
| LogP | 2.43090 |
| InChIKey | KTEIFCKZGZZTHP-UHFFFAOYSA-N |
| SMILES | C#CCOCCOS(=O)(=O)c1ccc(C)cc1 |
| 2-(2-propynyloxy)ethanol p-toluenesulfonate |
| 2-(propargyloxy)ethyl p-toluenesulfonate |
| 3-oxohex-5-ynyl tosylate |
| 2-(2-propynyloxy)ethyl tosylate |
| 2-prop-2-ynyloxyethyl p-toluenesulfonate |
| 2-(prop-2-ynyloxy)ethyl p-toluenesulfonate |