ethylenediaminetetraacetic acid dilithium salt
Modify Date: 2025-09-03 17:12:41
ethylenediaminetetraacetic acid dilithium salt structure
|
Common Name | ethylenediaminetetraacetic acid dilithium salt | ||
|---|---|---|---|---|
| CAS Number | 14531-56-7 | Molecular Weight | 304.10900 | |
| Density | N/A | Boiling Point | 614.2ºC at 760 mmHg | |
| Molecular Formula | C10H14Li2N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ethylenediaminetetraacetic acid dilithium saltEthylenediaminetetraacetic acid dilithium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | ethylenediaminetetraacetic acid dilithium salt |
|---|---|
| Synonym | More Synonyms |
| Description | Ethylenediaminetetraacetic acid dilithium salt is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Boiling Point | 614.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H14Li2N2O8 |
| Molecular Weight | 304.10900 |
| Exact Mass | 304.10700 |
| PSA | 161.34000 |
| Vapour Pressure | 1.15E-16mmHg at 25°C |
| InChIKey | RDSDRBIJHLVNSE-UHFFFAOYSA-L |
| SMILES | O=C([O-])CN(CCN(CC(=O)O)CC(=O)O)CC(=O)[O-].[Li+].[Li+] |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N,N',N'-tetraacetic acid dilithium salt |
| Dilithium EDTA |
| Einecs 238-557-9 |
| (ETHYLENEDINITRILO)TETRAACETIC ACID DILITHIUM SALT |
| edta dilithium salt hydrate |
| EDTA.Li2 |
| Dilithium ethylenediaminetetraacetate hydrate |
| ETHYLENEDIAMINETETRAACETIC ACID DILITHIUM |
| EDTA dilithium salt |
| MFCD00150462 |