GBT-440
Modify Date: 2025-08-23 09:36:34
GBT-440 structure
|
Common Name | GBT-440 | ||
|---|---|---|---|---|
| CAS Number | 1446321-46-5 | Molecular Weight | 337.372 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 539.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H19N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.9±30.1 °C | |
Use of GBT-440GBT 440 (Voxelotor) is an orally bioavailable modulator of sickle cell hemoglobin. |
| Name | voxelotor |
|---|---|
| Synonym | More Synonyms |
| Description | GBT 440 (Voxelotor) is an orally bioavailable modulator of sickle cell hemoglobin. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 539.2±50.0 °C at 760 mmHg |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.372 |
| Flash Point | 279.9±30.1 °C |
| Exact Mass | 337.142639 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | FWCVZAQENIZVMY-UHFFFAOYSA-N |
| SMILES | CC(C)n1nccc1-c1ncccc1COc1cccc(O)c1C=O |
| Storage condition | -20℃ |
| Benzaldehyde, 2-hydroxy-6-[[2-[1-(1-methylethyl)-1H-pyrazol-5-yl]-3-pyridinyl]methoxy]- |
| 2-Hydroxy-6-{[2-(1-isopropyl-1H-pyrazol-5-yl)-3-pyridinyl]methoxy}benzaldehyde |
| voxelotor |
| GBT-440 |
| GBT 440 |