Fmoc-Trp(Boc)-OH structure
|
Common Name | Fmoc-Trp(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 143824-78-6 | Molecular Weight | 526.58 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C31H30N2O6 | Melting Point | 86 - 90ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of Fmoc-Trp(Boc)-OHFmoc-L-Trp(Boc)-OH is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-L-Trp(Boc)-OH is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 86 - 90ºC |
| Molecular Formula | C31H30N2O6 |
| Molecular Weight | 526.58 |
| Exact Mass | 526.210388 |
| PSA | 106.86000 |
| LogP | 7.05 |
| Index of Refraction | 1.632 |
| InChIKey | ADOHASQZJSJZBT-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)n1cc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c2ccccc21 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H411 |
| Precautionary Statements | P273-P280 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Chemical synthesis of a polypeptide backbone derived from the primary sequence of the cancer protein NY-ESO-1 enabled by kinetically controlled ligation and pseudoprolines.
Biopolymers 104 , 116-27, (2015) The cancer protein NY-ESO-1 has been shown to be one of the most promising vaccine candidates although little is known about its cellular function. Using a chemical protein strategy, the 180 amino aci... |
|
|
Stimuli-Responsive Codelivery of Oligonucleotides and Drugs by Self-Assembled Peptide Nanoparticles.
Biomacromolecules 17 , 935-45, (2016) Ever more emerging combined treatments exploiting synergistic effects of drug combinations demand smart, responsive codelivery carriers to reveal their full potential. In this study, a multifunctional... |
| Fmoc-Trp(Boc)-OH |
| N(in)-Boc-Nalpha-Fmoc-L-tryptophan |
| Fmoc-L-Trp(Boc) |
| Nα-[(9H-Fluoren-9-ylMethoxy)carbonyl]-N1-tert-butoxycarbonyl-L-tryptophan |
| L-Tryptophan, 1-[(1,1-dimethylethoxy)carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| (2S)-3-{1-[(tert-butoxy)carbonyl]-1H-indol-3-yl}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| Fmoc-Trp(tert-butyloxycarbonyl)-OH |
| Nalpha-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N1-tert-butoxycarbonyl-L-tryptophan |
| N(in)-Boc-Nα-Fmoc-L-Tryptophan |
| Nα-Fmoc-N(in)-Boc-L-Tryptophan |
| N1-Boc-Nα-Fmoc-L-tryptophan |
| L B656 HHJ H1OVMYVQ1- DT56 BNJ BVOX1&1&1 &&L or S Form |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-tryptophan |
| Fmoc-L-Trp(Boc)-OH |
| N-Fmoc-NIn-Boc-L-trp |
| N-(9-fluorenyl)methoxycarbonyl-Trp(Boc)-OH |
| Nalpha-Fmoc-N(in)-Boc-L-tryptophan |
| 1-(tert-Butoxycarbonyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-tryptophan |
| MFCD00153366 |