(R)-Donepezil structure
|
Common Name | (R)-Donepezil | ||
|---|---|---|---|---|
| CAS Number | 142698-19-9 | Molecular Weight | 379.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-Donepezil(R)-Donepezil is a R-enantiomer of Donepezil (HY-14566). Donepezil is a specific and potent AChE inhibitor[1][2]. |
| Name | (R)-Donepezil |
|---|
| Description | (R)-Donepezil is a R-enantiomer of Donepezil (HY-14566). Donepezil is a specific and potent AChE inhibitor[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H29NO3 |
|---|---|
| Molecular Weight | 379.49 |
| InChIKey | ADEBPBSSDYVVLD-HXUWFJFHSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)C(CC1CCN(Cc3ccccc3)CC1)C2 |