Cdc7-IN-5
Modify Date: 2025-11-27 16:45:46
Cdc7-IN-5 structure
|
Common Name | Cdc7-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 1402057-86-6 | Molecular Weight | 445.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H23N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cdc7-IN-5Cdc7-IN-5 (compound I-B) is a potent Cdc7 kinase inhibitor extracted from patent WO2019165473A1, compound I-B. Cdc7 is a serine-threonine protein kinase enzyme which is essential for the initiation of DNA replication in the cell cycle[1]. |
| Name | Cdc7-IN-5 |
|---|
| Description | Cdc7-IN-5 (compound I-B) is a potent Cdc7 kinase inhibitor extracted from patent WO2019165473A1, compound I-B. Cdc7 is a serine-threonine protein kinase enzyme which is essential for the initiation of DNA replication in the cell cycle[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H23N3O5 |
|---|---|
| Molecular Weight | 445.47 |
| InChIKey | JSRLUFXDTSIAKH-FOWTUZBSSA-N |
| SMILES | CCOC(=O)c1c(N2CCc3ccc(OC)cc3C2)oc(C=C2C=Nc3ncccc32)c1O |