Pterisolic acid F
Modify Date: 2025-09-05 09:40:47
Pterisolic acid F structure
|
Common Name | Pterisolic acid F | ||
|---|---|---|---|---|
| CAS Number | 1401419-90-6 | Molecular Weight | 366.45 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 583.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.8±26.6 °C | |
Use of Pterisolic acid FPterisolic acid F can be isolated from the ethanol extract of the fern Pteris semipinnata (Pteridaceae)[1]. |
| Name | Pterisolic acid F |
|---|---|
| Synonym | More Synonyms |
| Description | Pterisolic acid F can be isolated from the ethanol extract of the fern Pteris semipinnata (Pteridaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 583.6±50.0 °C at 760 mmHg |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 |
| Flash Point | 320.8±26.6 °C |
| Exact Mass | 366.204254 |
| PSA | 115.06000 |
| LogP | 0.74 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | DEXISWHCLDQHNE-XPDSNTSVSA-N |
| SMILES | CC1(C(=O)O)CCCC2(C)C1CCC13CC(CCC12O)C(O)(CO)C3=O |
| Hazard Codes | Xi |
|---|
| (5β,8α,9β,10α,13α)-9,16,17-Trihydroxy-15-oxokauran-18-oic acid |