Ganoderic acid F
Modify Date: 2025-08-25 12:28:50
Ganoderic acid F structure
|
Common Name | Ganoderic acid F | ||
|---|---|---|---|---|
| CAS Number | 98665-15-7 | Molecular Weight | 570.670 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 709.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C32H42O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.9±26.4 °C | |
Use of Ganoderic acid FGanoderic acid F is a ganoderic acid. Ganoderic acid F exhibits antitumor and antimetastatic activities through inhibition of angiogenesis and alteration of proteins involving cell proliferation and/or cell death, carcinogenesis, oxidative stress, calcium signaling, and endoplasmic reticulum stress[1][2]. |
| Name | CLQ52DLW7V |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid F is a ganoderic acid. Ganoderic acid F exhibits antitumor and antimetastatic activities through inhibition of angiogenesis and alteration of proteins involving cell proliferation and/or cell death, carcinogenesis, oxidative stress, calcium signaling, and endoplasmic reticulum stress[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Ganoderic acid F (48 hours) inhibits the proliferation of HeLa human cervical carcinoma cells with an IC50 value of 19.5 μM[2]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 709.3±60.0 °C at 760 mmHg |
| Molecular Formula | C32H42O9 |
| Molecular Weight | 570.670 |
| Flash Point | 222.9±26.4 °C |
| Exact Mass | 570.282898 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | BWCNWXLKMWWVBT-AIMUVTGPSA-N |
| SMILES | CC(=O)OC1C(=O)C2=C(C(=O)CC3C(C)(C)C(=O)CCC23C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C |
| Water Solubility | Insuluble (6.8E-4 g/L) (25 ºC) |
| Lanost-8-en-26-oic acid, 12-(acetyloxy)-3,7,11,15,23-pentaoxo-, (12β)- |
| UNII:CLQ52DLW7V |
| (12β)-12-Acetoxy-3,7,11,15,23-pentaoxolanost-8-en-26-oic acid |
| MFCD09264655 |
| Ganoderic acid F |