PF 4800567 hydrochloride structure
|
Common Name | PF 4800567 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1391052-28-0 | Molecular Weight | 396.271 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19Cl2N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF 4800567 hydrochloridePF-4800567 hydrochloride is a casein kinase 1e (CK1e) selective inhibitor (IC50 = 32 nM) that is 20 fold selective for the CK1e isoform over CK1d. PF-4800567 blockes CK1e-mediated PER3 nuclear translocation, but does not effect the circadian clock in animal studies. |
| Name | 3-[(3-chlorophenoxy)methyl]-1-tetrahydropyran-4-yl-pyrazolo[3,4-d]pyrimidin-4-amine;hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H19Cl2N5O2 |
|---|---|
| Molecular Weight | 396.271 |
| Exact Mass | 395.091583 |
| InChIKey | QZXZQMUZEHTFHD-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ncnc2c1c(COc1cccc(Cl)c1)nn2C1CCOCC1 |
| MFCD20926348 |