(±)-Marmesin structure
|
Common Name | (±)-Marmesin | ||
|---|---|---|---|---|
| CAS Number | 13710-70-8 | Molecular Weight | 246.259 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 434.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.0±22.2 °C | |
Use of (±)-Marmesin(±)-Marmesin is a good precursor of the linear furanocoumarins. (±)-Marmesin derivatives have high degree of acetylcholinesterase inhibitory property[1][2]. |
| Name | marmesin |
|---|---|
| Synonym | More Synonyms |
| Description | (±)-Marmesin is a good precursor of the linear furanocoumarins. (±)-Marmesin derivatives have high degree of acetylcholinesterase inhibitory property[1][2]. |
|---|---|
| Related Catalog | |
| Target |
AChE |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.0±45.0 °C at 760 mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.259 |
| Flash Point | 168.0±22.2 °C |
| Exact Mass | 246.089203 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | FWYSBEAFFPBAQU-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C1Cc2cc3ccc(=O)oc3cc2O1 |
| 2-(2-Hydroxy-2-propanyl)-2,3-dihydro-7H-furo[3,2-g]chromen-7-one |
| marmesin |
| 2-(2-hydroxypropan-2-yl)-2,3-dihydro-7H-furo[3,2-g]chromen-7-one |
| 7H-Furo[3,2-g][1]benzopyran-7-one, 2,3-dihydro-2-(1-hydroxy-1-methylethyl)- |
| 2-(1-Hydroxy-1-methyl-ethyl)-2,3-dihydro-furo[3,2-g]chromen-7-one |
| 2-(1-Hydroxy-1-methylethyl)-2,3-dihydrofuro[3,2-g]chromen-7-one |