DNP-PEG3-DNP
Modify Date: 2025-08-21 17:49:26
DNP-PEG3-DNP structure
|
Common Name | DNP-PEG3-DNP | ||
|---|---|---|---|---|
| CAS Number | 1365655-92-0 | Molecular Weight | 524.438 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 735.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C20H24N6O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 398.5±32.9 °C | |
Use of DNP-PEG3-DNPDNP-PEG3-DNP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | DNP-PEG3-DNP |
|---|---|
| Synonym | More Synonyms |
| Description | DNP-PEG3-DNP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 735.3±60.0 °C at 760 mmHg |
| Molecular Formula | C20H24N6O11 |
| Molecular Weight | 524.438 |
| Flash Point | 398.5±32.9 °C |
| Exact Mass | 524.150330 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | DCJHARRKAIYZFB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCOCCOCCOCCNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| N,N'-[Oxybis(2,1-ethanediyloxy-2,1-ethanediyl)]bis(2,4-dinitroaniline) |
| Benzenamine, N,N'-[oxybis(2,1-ethanediyloxy-2,1-ethanediyl)]bis[2,4-dinitro- |
| MFCD22056318 |