DNP-PEG3-azide
Modify Date: 2025-09-20 22:09:40
DNP-PEG3-azide structure
|
Common Name | DNP-PEG3-azide | ||
|---|---|---|---|---|
| CAS Number | 951671-87-7 | Molecular Weight | 384.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DNP-PEG3-azideDNP-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | DNP-PEG3-azide |
|---|
| Description | DNP-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H20N6O7 |
|---|---|
| Molecular Weight | 384.34 |
| InChIKey | FIAOTUUAWJBUBV-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |