S-14671 structure
|
Common Name | S-14671 | ||
|---|---|---|---|---|
| CAS Number | 135722-27-9 | Molecular Weight | 395.51800 | |
| Density | 1.225g/cm3 | Boiling Point | 646.7ºC at 760 mmHg | |
| Molecular Formula | C22H25N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.9ºC | |
Use of S-14671S-14671 is a high-affinity 5-HT1A agonist (pKi=9.3). S-14671 can be used for research on neurological diseases, such as anti-anxiety, anti-depression, etc[1]. |
| Name | N-[2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl]thiophene-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | S-14671 is a high-affinity 5-HT1A agonist (pKi=9.3). S-14671 can be used for research on neurological diseases, such as anti-anxiety, anti-depression, etc[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT1A Receptor:9.3 (pKi) |
| References |
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 646.7ºC at 760 mmHg |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.51800 |
| Flash Point | 344.9ºC |
| Exact Mass | 395.16700 |
| PSA | 73.05000 |
| LogP | 3.85570 |
| Vapour Pressure | 1.3E-16mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | YFNZHCXOYLKDGU-UHFFFAOYSA-N |
| SMILES | COc1ccc2cccc(N3CCN(CCNC(=O)c4cccs4)CC3)c2c1 |
| 4-((Thenoyl)-2-aminoethyl)-1-(7-methoxynaphthylpiperazine) |
| N-{2-[4-(7-methoxynaphthalen-1-yl)piperazin-1-yl]ethyl}thiophene-2-carboxamide |