Lamivudine structure
|
Common Name | Lamivudine | ||
|---|---|---|---|---|
| CAS Number | 134678-17-4 | Molecular Weight | 229.256 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 475.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C8H11N3O3S | Melting Point | 177 °C | |
| MSDS | Chinese USA | Flash Point | 241.3±31.5 °C | |
| Symbol |
GHS08 |
Signal Word | Warning | |
Use of LamivudineLamivudine is a nucleoside reverse transcriptase inhibitors?(NRTIs). Lamivudine can inhibit HIV reverse transcriptase 1/2 and also the reverse transcriptase of hepatitis B virus. |
| Name | lamivudine |
|---|---|
| Synonym | More Synonyms |
| Description | Lamivudine is a nucleoside reverse transcriptase inhibitors?(NRTIs). Lamivudine can inhibit HIV reverse transcriptase 1/2 and also the reverse transcriptase of hepatitis B virus. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.4±55.0 °C at 760 mmHg |
| Melting Point | 177 °C |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.256 |
| Flash Point | 241.3±31.5 °C |
| Exact Mass | 229.052109 |
| PSA | 115.67000 |
| LogP | -0.71 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | JTEGQNOMFQHVDC-NKWVEPMBSA-N |
| SMILES | Nc1ccn(C2CSC(CO)O2)c(=O)n1 |
| Storage condition | Freezer |
| HS Code | 2938901000 |
|---|---|
| Summary | HS: 2938901000. 4-amino-1-((2r,5s)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidin-2(1h)-one. VAT:17.0%. tax rebate rate:13.0%. supervision conditions:None. MFN tarrif:6.5%. general tariff:20.0% |
|
Transporter-mediated uptake of UDP-glucuronic acid by human liver microsomes: assay conditions, kinetics, and inhibition.
Drug Metab. Dispos. 43(1) , 147-53, (2014) This study characterized the kinetics, variability, and factors that affect UDP-glucuronic acid (UDP-GlcUA) uptake by human liver microsomes (HLM). Biphasic kinetics were observed for UDP-GlcUA uptake... |
|
|
Quantitative mass spectrometry imaging of emtricitabine in cervical tissue model using infrared matrix-assisted laser desorption electrospray ionization.
Anal. Bioanal. Chem 407(8) , 2073-84, (2015) A quantitative mass spectrometry imaging (QMSI) technique using infrared matrix-assisted laser desorption electrospray ionization (IR-MALDESI) is demonstrated for the antiretroviral (ARV) drug emtrici... |
|
|
The stress response resolution assay. I. Quantitative assessment of environmental agent/condition effects on cellular stress resolution outcomes in epithelium.
Environ. Mol. Mutagen. 54(4) , 268-80, (2013) The events or factors that lead from normal cell function to conditions and diseases such as aging or cancer reflect complex interactions between cells and their environment. Cellular stress responses... |
| 2(1H)-Pyrimidinone, 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]- |
| 3TC |
| Heptodin |
| cent |
| (-)-1-[(2R,5S)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl]cytosine |
| Lamivudine |
| Zeffix |
| Zefix |
| Hepitec |
| Heptivir |
| 2(1H)-Pyrimidinone, 4-amino-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl], (-)(2R,5S) |
| 2',3'-Dideoxy-3'-thiacytidine |
| Heptovir |
| 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2(1H)-one |
| MFCD00869739 |
| (-)-1-((2R,5S)-2-(Hydroxymethyl)-1,3-oxathiolan-5-yl)cystosine |
| 4-Amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone |
| Epivir |
| 4-Amino-1-((2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidin-2(1H)-one |
| 3&L-SddC |