Iloperidone metabolite Hydroxy Iloperidone structure
|
Common Name | Iloperidone metabolite Hydroxy Iloperidone | ||
|---|---|---|---|---|
| CAS Number | 133454-55-4 | Molecular Weight | 428.49600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H29FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 48.2 °F | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
Use of Iloperidone metabolite Hydroxy IloperidoneHydroxy Iloperidone is a metabolite of Iloperidone, which is an atypical antipsychotic. |
| Name | 1-[4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy Iloperidone is a metabolite of Iloperidone, which is an atypical antipsychotic. |
|---|---|
| Related Catalog |
| Molecular Formula | C24H29FN2O4 |
|---|---|
| Molecular Weight | 428.49600 |
| Exact Mass | 428.21100 |
| PSA | 67.96000 |
| LogP | 4.61520 |
| InChIKey | SBKZGLWZGZQVHA-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)O)ccc1OCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol |
| Flash Point(F) | 48.2 °F |
| Flash Point(C) | 9 °C |
|
~69%
Iloperidone met... CAS#:133454-55-4 |
| Literature: Strupczewski; Bordeau; Chiang; Glamkowski; Conway; Corbett; Hartman; Szewczak; Wilmot; Helsley Journal of Medicinal Chemistry, 1995 , vol. 38, # 7 p. 1119 - 1131 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| P 88 |
| P 88-8991 |
| Hydroxy Iloperidone |
| 1-[4-[3-[4-(6-fluoro-1,2-benzisoxazol-3-yl)-1-piperidinyl]propoxy]-3-methoxyphenyl]ethanol |
| 1-(4-{3-[4-(6-fluoro-benzo[d]isoxazol-3-yl)-piperidin-1-yl]-propoxy}-3-methoxy-phenyl)-ethanol |
| Iloperidone metabolite Hydroxy Iloperidone |