CX-5011 structure
|
Common Name | CX-5011 | ||
|---|---|---|---|---|
| CAS Number | 1333382-30-1 | Molecular Weight | 362.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H11N4NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CX-5011CX-5011 is a CK2 inhibitor. CX-5011 also induces Rac1 activation. CX-5011 induces apoptosis and induces cancer cell death[1][2]. |
| Name | sodium,5-(3-ethynylanilino)pyrimido[4,5-c]quinoline-8-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | CX-5011 is a CK2 inhibitor. CX-5011 also induces Rac1 activation. CX-5011 induces apoptosis and induces cancer cell death[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H11N4NaO2 |
|---|---|
| Molecular Weight | 362.31700 |
| Exact Mass | 362.07800 |
| PSA | 90.83000 |
| LogP | 2.33940 |
| InChIKey | FSIFELDKZUCPMJ-UHFFFAOYSA-M |
| SMILES | C#Cc1cccc(Nc2nc3cc(C(=O)[O-])ccc3c3cncnc23)c1.[Na+] |
| UNII-2F5JG09KS6 |
| Pyrimido(4,5-C)quinoline-8-carboxylic acid,5-((3-ethynylphenyl)amino)-,sodium salt (1:1) |
| CX-5011 |