Tolnaftate-d7
Modify Date: 2025-08-25 19:37:10
Tolnaftate-d7 structure
|
Common Name | Tolnaftate-d7 | ||
|---|---|---|---|---|
| CAS Number | 1329835-64-4 | Molecular Weight | 314.453 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 453.4±38.0 °C at 760 mmHg | |
| Molecular Formula | C19H10D7NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.0±26.8 °C | |
Use of Tolnaftate-d7Tolnaftate D7 (NP-27 D7) is the deuterium labeled Tolnaftate. Tolnaftate (NP-27) is a synthetic thiocarbamate used as an anti-fungal agent[1][2]. |
| Name | Tolnaftate-d7 |
|---|---|
| Synonym | More Synonyms |
| Description | Tolnaftate D7 (NP-27 D7) is the deuterium labeled Tolnaftate. Tolnaftate (NP-27) is a synthetic thiocarbamate used as an anti-fungal agent[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 453.4±38.0 °C at 760 mmHg |
| Molecular Formula | C19H10D7NOS |
| Molecular Weight | 314.453 |
| Flash Point | 228.0±26.8 °C |
| Exact Mass | 314.147034 |
| LogP | 5.15 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | FUSNMLFNXJSCDI-BTSZWIDXSA-N |
| SMILES | Cc1cccc(N(C)C(=S)Oc2ccc3ccccc3c2)c1 |
| Carbamothioic acid, N-methyl-N-(3-methylphenyl)-, O-2-naphthalenyl-d7 ester |
| Tolnaftate-d7 |
| O-(2H7)-2-Naphthyl methyl(3-methylphenyl)carbamothioate |