Solanesol structure
|
Common Name | Solanesol | ||
|---|---|---|---|---|
| CAS Number | 13190-97-1 | Molecular Weight | 631.068 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 685.6±24.0 °C at 760 mmHg | |
| Molecular Formula | C45H74O | Melting Point | 33°C | |
| MSDS | N/A | Flash Point | 130.3±19.2 °C | |
Use of SolanesolSolanesol is an aliphatic terpene alcohol mainly found in Solanaceous plants, with anti-inflammatory, neuroprotective, and antimicrobial activities[1]. |
| Name | Solanesol |
|---|---|
| Synonym | More Synonyms |
| Description | Solanesol is an aliphatic terpene alcohol mainly found in Solanaceous plants, with anti-inflammatory, neuroprotective, and antimicrobial activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 685.6±24.0 °C at 760 mmHg |
| Melting Point | 33°C |
| Molecular Formula | C45H74O |
| Molecular Weight | 631.068 |
| Flash Point | 130.3±19.2 °C |
| Exact Mass | 630.573975 |
| PSA | 20.23000 |
| LogP | 17.52 |
| Vapour Pressure | 0.0±4.8 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | AFPLNGZPBSKHHQ-MEGGAXOGSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCO |
| Storage condition | −20°C |
| Stability | Stable, but may be heat sensitive - store cold. Combustible. Incompatible with strong oxidizing agents. |
| WGK Germany | 3 |
|---|---|
| RTECS | MP5366666 |
| HS Code | 2905229000 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2905229000 |
|---|
| MFCD00070279 |
| (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaen-1-ol |
| Farnesylfarnesylfarnesol |
| 3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-ol |
| prenol-9 all-trans |
| Nonaisoprenol |
| Solanesol from tobacco |
| 2,6,10,14,18,22,26,30,34-Hexatriacontanonaen-1-ol, 3,7,11,15,19,23,27,31,35-nonamethyl-, (2E,6E,10E,14E,18E,22E,26E,30E)- |
| betulanonaprenol |
| 3,7,11,15,19,23,27,31,35-nonamethyl-hexatriaconta-2t,6t,10t,14t,18t,22t,26t,30t,34-nonaen-1-ol |
| (2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-Nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaen-1-ol |
| betulaprenol9 |
| Solanesol |