Z-Gly-Gly-Phe-OH structure
|
Common Name | Z-Gly-Gly-Phe-OH | ||
|---|---|---|---|---|
| CAS Number | 13171-93-2 | Molecular Weight | 413.42400 | |
| Density | 1.301 g/cm3 | Boiling Point | 771.2ºC at 760 mmHg | |
| Molecular Formula | C21H23N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 420.2ºC | |
Use of Z-Gly-Gly-Phe-OHZ-Gly-Gly-Phe-OH is an active compound. Z-Gly-Gly-Phe-OH can be used for the synthesis of enzymic peptide[1]. |
| Name | 3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Gly-Gly-Phe-OH is an active compound. Z-Gly-Gly-Phe-OH can be used for the synthesis of enzymic peptide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.301 g/cm3 |
|---|---|
| Boiling Point | 771.2ºC at 760 mmHg |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.42400 |
| Flash Point | 420.2ºC |
| Exact Mass | 413.15900 |
| PSA | 133.83000 |
| LogP | 2.01380 |
| Vapour Pressure | 5.08E-25mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | PARPWSYTROKYNG-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2934999090 |
|---|
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Z-Gly-Gly-L-Phe-OH |
| Cbz-Gly-Gly-L-Phe |
| N-benzyloxycarbonyl-glycylglycyl-L-phenylalanine |
| carbobenzoxyglycylglycyl-L-phenylalanine |
| Cbz-Gly-Gly-Phe-OH |
| N-benzyloxycarbonyl-L-glycyl-L-glycyl-L-phenylalanine |
| N-Cbz-glycylglycylphenylalanine |